Structure of PDB 3vv7 Chain A Binding Site BS01 |
|
|
Ligand ID | 0B1 |
InChI | InChI=1S/C21H21N3O2/c1-24-20(25)12-19(23-21(24)22)18-11-17(18)15-7-3-5-13(9-15)14-6-4-8-16(10-14)26-2/h3-10,12,17-18H,11H2,1-2H3,(H2,22,23)/t17-,18-/m0/s1 |
InChIKey | QECXNBWGUGUPSI-ROUUACIJSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CN1C(=O)C=C(N=C1N)C2CC2c3cccc(c3)c4cccc(c4)OC | CACTVS 3.370 | COc1cccc(c1)c2cccc(c2)[CH]3C[CH]3C4=CC(=O)N(C)C(=N4)N | ACDLabs 12.01 | O=C1C=C(N=C(N)N1C)C4CC4c3cccc(c2cccc(OC)c2)c3 | OpenEye OEToolkits 1.7.6 | CN1C(=O)C=C(N=C1N)[C@H]2C[C@H]2c3cccc(c3)c4cccc(c4)OC | CACTVS 3.370 | COc1cccc(c1)c2cccc(c2)[C@@H]3C[C@@H]3C4=CC(=O)N(C)C(=N4)N |
|
Formula | C21 H21 N3 O2 |
Name | 2-amino-6-[(1S,2R)-2-(3'-methoxybiphenyl-3-yl)cyclopropyl]-3-methylpyrimidin-4(3H)-one |
ChEMBL | CHEMBL2169933 |
DrugBank | |
ZINC | ZINC000095557316
|
PDB chain | 3vv7 Chain A Residue 509
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|