Structure of PDB 3vng Chain A Binding Site BS01 |
|
|
Ligand ID | FUU |
InChI | InChI=1S/C16H14N4O6/c21-13(22)9-25-11-4-1-3-10(7-11)8-17-15(23)18-16-20-19-14(26-16)12-5-2-6-24-12/h1-7H,8-9H2,(H,21,22)(H2,17,18,20,23) |
InChIKey | COAUEHYQQBGZLC-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(Nc1nnc(o1)c2occc2)NCc3cccc(OCC(=O)O)c3 | CACTVS 3.370 | OC(=O)COc1cccc(CNC(=O)Nc2oc(nn2)c3occc3)c1 | OpenEye OEToolkits 1.7.6 | c1cc(cc(c1)OCC(=O)O)CNC(=O)Nc2nnc(o2)c3ccco3 |
|
Formula | C16 H14 N4 O6 |
Name | 2-(3-((3-(5-(furan-2-yl)-1,3,4-oxadiazol-2-yl)ureido)methyl)phenoxy)acetic acid |
ChEMBL | CHEMBL4576082 |
DrugBank | |
ZINC | ZINC000095920723
|
PDB chain | 3vng Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|