Structure of PDB 3vf8 Chain A Binding Site BS01 |
|
|
Ligand ID | 0JE |
InChI | InChI=1S/C17H21FN6O2/c1-4-24(5-2)17(25)22-13-9-19-23-15(13)16-20-11-7-10(18)14(26-6-3)8-12(11)21-16/h7-9H,4-6H2,1-3H3,(H,19,23)(H,20,21)(H,22,25) |
InChIKey | UJXIKUVGGQECLJ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CCN(CC)C(=O)Nc1cn[nH]c1c2[nH]c3cc(c(cc3n2)OCC)F | ACDLabs 12.01 | O=C(Nc3c(c2nc1cc(OCC)c(F)cc1n2)nnc3)N(CC)CC | CACTVS 3.370 | CCOc1cc2nc([nH]c2cc1F)c3[nH]ncc3NC(=O)N(CC)CC |
|
Formula | C17 H21 F N6 O2 |
Name | 3-[5-(5-ethoxy-6-fluoro-1H-benzimidazol-2-yl)-1H-pyrazol-4-yl]-1,1-diethylurea |
ChEMBL | CHEMBL2017551 |
DrugBank | |
ZINC | ZINC000084587050
|
PDB chain | 3vf8 Chain A Residue 701
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|