Structure of PDB 3v5p Chain A Binding Site BS01 |
|
|
Ligand ID | C88 |
InChI | InChI=1S/C19H24N6O/c1-12-9-14(3-4-15(12)26-2)17-16-18(20)22-11-23-19(16)25(24-17)10-13-5-7-21-8-6-13/h3-4,9,11,13,21H,5-8,10H2,1-2H3,(H2,20,22,23) |
InChIKey | MQULVMDBNSSIMR-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | COc1ccc(cc1C)c2nn(CC3CCNCC3)c4ncnc(N)c24 | ACDLabs 12.01 | n1c(c2c(nc1)n(nc2c3ccc(OC)c(c3)C)CC4CCNCC4)N | OpenEye OEToolkits 1.7.6 | Cc1cc(ccc1OC)c2c3c(ncnc3n(n2)CC4CCNCC4)N |
|
Formula | C19 H24 N6 O |
Name | 3-(4-methoxy-3-methylphenyl)-1-(piperidin-4-ylmethyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine |
ChEMBL | CHEMBL2030558 |
DrugBank | |
ZINC | ZINC000084669858
|
PDB chain | 3v5p Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|