Structure of PDB 3umw Chain A Binding Site BS01 |
|
|
Ligand ID | 596 |
InChI | InChI=1S/C22H22N4O3/c1-28-19-7-6-15-21(27)20(12-18-14-4-2-3-5-17(14)24-25-18)29-22(15)16(19)13-26-10-8-23-9-11-26/h2-7,12,23H,8-11,13H2,1H3,(H,24,25)/b20-12- |
InChIKey | HZMQZYRYZGLOKJ-NDENLUEZSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | COc1ccc2C(=O)C(/Oc2c1CN3CCNCC3)=C/c4n[nH]c5ccccc45 | OpenEye OEToolkits 1.7.6 | COc1ccc2c(c1CN3CCNCC3)OC(=Cc4c5ccccc5[nH]n4)C2=O | ACDLabs 12.01 | O=C1c4ccc(OC)c(c4O/C1=C\c3nnc2ccccc23)CN5CCNCC5 | OpenEye OEToolkits 1.7.6 | COc1ccc2c(c1CN3CCNCC3)O/C(=C\c4c5ccccc5[nH]n4)/C2=O | CACTVS 3.370 | COc1ccc2C(=O)C(Oc2c1CN3CCNCC3)=Cc4n[nH]c5ccccc45 |
|
Formula | C22 H22 N4 O3 |
Name | (2Z)-2-(1H-indazol-3-ylmethylidene)-6-methoxy-7-(piperazin-1-ylmethyl)-1-benzofuran-3(2H)-one |
ChEMBL | CHEMBL2147845 |
DrugBank | |
ZINC |
|
PDB chain | 3umw Chain A Residue 400
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|