Structure of PDB 3udr Chain A Binding Site BS01 |
|
|
Ligand ID | 09F |
InChI | InChI=1S/C19H21N3O3/c20-11-18(8-4-1-5-9-18)25-16(23)15-10-19(12-21-15)13-6-2-3-7-14(13)22-17(19)24/h2-3,6-7,15,21H,1,4-5,8-10,12H2,(H,22,24)/t15-,19-/m1/s1 |
InChIKey | VRCMTLQTPNLTIN-DNVCBOLYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | O=C1Nc2ccccc2[C]13CN[CH](C3)C(=O)OC4(CCCCC4)C#N | ACDLabs 12.01 | N#CC4(OC(=O)C3NCC1(c2c(NC1=O)cccc2)C3)CCCCC4 | OpenEye OEToolkits 1.7.2 | c1ccc2c(c1)C3(CC(NC3)C(=O)OC4(CCCCC4)C#N)C(=O)N2 | CACTVS 3.370 | O=C1Nc2ccccc2[C@@]13CN[C@H](C3)C(=O)OC4(CCCCC4)C#N | OpenEye OEToolkits 1.7.2 | c1ccc2c(c1)[C@]3(C[C@@H](NC3)C(=O)OC4(CCCCC4)C#N)C(=O)N2 |
|
Formula | C19 H21 N3 O3 |
Name | 1-cyanocyclohexyl (3S,5'R)-2-oxo-1,2-dihydrospiro[indole-3,3'-pyrrolidine]-5'-carboxylate |
ChEMBL | CHEMBL2181985 |
DrugBank | |
ZINC | ZINC000095575049
|
PDB chain | 3udr Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|