Structure of PDB 3udn Chain A Binding Site BS01 |
|
|
Ligand ID | 09B |
InChI | InChI=1S/C20H17N3O3/c21-10-13-5-7-14(8-6-13)11-26-18(24)17-9-20(12-22-17)15-3-1-2-4-16(15)23-19(20)25/h1-8,17,22H,9,11-12H2,(H,23,25)/t17-,20-/m1/s1 |
InChIKey | QVGGPTMZUCXDDT-YLJYHZDGSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.2 | c1ccc2c(c1)C3(CC(NC3)C(=O)OCc4ccc(cc4)C#N)C(=O)N2 | OpenEye OEToolkits 1.7.2 | c1ccc2c(c1)[C@]3(C[C@@H](NC3)C(=O)OCc4ccc(cc4)C#N)C(=O)N2 | CACTVS 3.370 | O=C1Nc2ccccc2[C@@]13CN[C@H](C3)C(=O)OCc4ccc(cc4)C#N | CACTVS 3.370 | O=C1Nc2ccccc2[C]13CN[CH](C3)C(=O)OCc4ccc(cc4)C#N | ACDLabs 12.01 | N#Cc1ccc(cc1)COC(=O)C4NCC2(c3c(NC2=O)cccc3)C4 |
|
Formula | C20 H17 N3 O3 |
Name | 4-cyanobenzyl (3S,5'R)-2-oxo-1,2-dihydrospiro[indole-3,3'-pyrrolidine]-5'-carboxylate |
ChEMBL | CHEMBL2181980 |
DrugBank | |
ZINC | ZINC000095573978
|
PDB chain | 3udn Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|