Structure of PDB 3u6a Chain A Binding Site BS01 |
|
|
Ligand ID | 18P |
InChI | InChI=1S/C18H18ClN5O2/c1-18(17(26)24(2)10-15(20)23-18)11-4-3-5-13(8-11)22-16(25)14-7-6-12(19)9-21-14/h3-9H,10H2,1-2H3,(H2,20,23)(H,22,25)/t18-/m1/s1 |
InChIKey | MRYFMHAPTQCQLE-GOSISDBHSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CN1CC(=N[C@@](C)(C1=O)c2cccc(NC(=O)c3ccc(Cl)cn3)c2)N | ACDLabs 12.01 | Clc1ccc(nc1)C(=O)Nc2cccc(c2)C3(N=C(N)CN(C3=O)C)C | OpenEye OEToolkits 1.7.2 | C[C@]1(C(=O)N(CC(=N1)N)C)c2cccc(c2)NC(=O)c3ccc(cn3)Cl | OpenEye OEToolkits 1.7.2 | CC1(C(=O)N(CC(=N1)N)C)c2cccc(c2)NC(=O)c3ccc(cn3)Cl | CACTVS 3.370 | CN1CC(=N[C](C)(C1=O)c2cccc(NC(=O)c3ccc(Cl)cn3)c2)N |
|
Formula | C18 H18 Cl N5 O2 |
Name | N-{3-[(2R)-6-amino-2,4-dimethyl-3-oxo-2,3,4,5-tetrahydropyrazin-2-yl]phenyl}-5-chloropyridine-2-carboxamide |
ChEMBL | CHEMBL1923160 |
DrugBank | |
ZINC | ZINC000072318808
|
PDB chain | 3u6a Chain A Residue 386
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|