Structure of PDB 3tye Chain A Binding Site BS01 |
|
|
Ligand ID | XTZ |
InChI | InChI=1S/C16H16N8O3S2/c17-15-22-13-12(14(25)23-15)21-10(8-20-13)7-19-9-1-3-11(4-2-9)29(26,27)24-16-18-5-6-28-16/h1-6,19H,7-8H2,(H,18,24)(H4,17,20,22,23,25) |
InChIKey | XKJZNFKQXDBJHJ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | NC1=NC2=C(N=C(CNc3ccc(cc3)[S](=O)(=O)Nc4sccn4)CN2)C(=O)N1 | ACDLabs 12.01 | O=S(=O)(Nc1nccs1)c4ccc(NCC3=NC2=C(N=C(N)NC2=O)NC3)cc4 | OpenEye OEToolkits 1.7.2 | c1cc(ccc1NCC2=NC3=C(NC2)N=C(NC3=O)N)S(=O)(=O)Nc4nccs4 |
|
Formula | C16 H16 N8 O3 S2 |
Name | 4-{[(2-amino-4-oxo-3,4,7,8-tetrahydropteridin-6-yl)methyl]amino}-N-(1,3-thiazol-2-yl)benzenesulfonamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920774
|
PDB chain | 3tye Chain A Residue 801
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|