Structure of PDB 3tud Chain A Binding Site BS01 |
|
|
Ligand ID | FPX |
InChI | InChI=1S/C29H22F3N5O2/c1-17-11-12-22(34-26(38)18-7-6-8-20(13-18)29(30,31)32)15-23(17)24-14-19-16-33-28(35-21-9-4-3-5-10-21)36-25(19)37(2)27(24)39/h3-16H,1-2H3,(H,34,38)(H,33,35,36) |
InChIKey | IMLLFFIWQIAPHC-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CN1C(=O)C(=Cc2cnc(Nc3ccccc3)nc12)c4cc(NC(=O)c5cccc(c5)C(F)(F)F)ccc4C | ACDLabs 12.01 | FC(F)(F)c1cccc(c1)C(=O)Nc5cc(C4=Cc2c(nc(nc2)Nc3ccccc3)N(C4=O)C)c(cc5)C | OpenEye OEToolkits 1.7.2 | Cc1ccc(cc1C2=Cc3cnc(nc3N(C2=O)C)Nc4ccccc4)NC(=O)c5cccc(c5)C(F)(F)F |
|
Formula | C29 H22 F3 N5 O2 |
Name | N-{4-methyl-3-[8-methyl-7-oxo-2-(phenylamino)-7,8-dihydropyrido[2,3-d]pyrimidin-6-yl]phenyl}-3-(trifluoromethyl)benzamide |
ChEMBL | CHEMBL4065618 |
DrugBank | |
ZINC | ZINC000089469766
|
PDB chain | 3tud Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|