Structure of PDB 3tub Chain A Binding Site BS01 |
|
|
Ligand ID | FPU |
InChI | InChI=1S/C26H24N4O4/c1-32-23-13-19-20(14-24(23)33-2)27-11-10-22(19)34-17-8-9-25(28-15-17)30-26(31)29-21-12-18(21)16-6-4-3-5-7-16/h3-11,13-15,18,21H,12H2,1-2H3,(H2,28,29,30,31)/t18-,21+/m0/s1 |
InChIKey | MRWNNBQFJVSSHG-GHTZIAJQSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | COc1cc2nccc(Oc3ccc(NC(=O)N[CH]4C[CH]4c5ccccc5)nc3)c2cc1OC | OpenEye OEToolkits 1.7.2 | COc1cc2c(ccnc2cc1OC)Oc3ccc(nc3)NC(=O)NC4CC4c5ccccc5 | ACDLabs 12.01 | O=C(Nc3ncc(Oc1c2cc(OC)c(OC)cc2ncc1)cc3)NC5CC5c4ccccc4 | OpenEye OEToolkits 1.7.2 | COc1cc2c(ccnc2cc1OC)Oc3ccc(nc3)NC(=O)N[C@@H]4C[C@H]4c5ccccc5 | CACTVS 3.370 | COc1cc2nccc(Oc3ccc(NC(=O)N[C@@H]4C[C@H]4c5ccccc5)nc3)c2cc1OC |
|
Formula | C26 H24 N4 O4 |
Name | 1-{5-[(6,7-dimethoxyquinolin-4-yl)oxy]pyridin-2-yl}-3-[(1R,2S)-2-phenylcyclopropyl]urea |
ChEMBL | |
DrugBank | |
ZINC | ZINC000089469759
|
PDB chain | 3tub Chain A Residue 999
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|