Structure of PDB 3tti Chain A Binding Site BS01 |
|
|
Ligand ID | KBI |
InChI | InChI=1S/C21H23F3N6O2/c22-11-7-15(23)18(16(24)8-11)28-21-27-17-9-25-20(26-12-1-3-14(31)4-2-12)29-19(17)30(21)13-5-6-32-10-13/h7-9,12-14,31H,1-6,10H2,(H,27,28)(H,25,26,29)/t12-,13-,14-/m0/s1 |
InChIKey | IBGLGMOPHJQDJB-IHRRRGAJSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | O[C@@H]1CC[C@H](CC1)Nc2ncc3nc(Nc4c(F)cc(F)cc4F)n([C@H]5CCOC5)c3n2 | ACDLabs 12.01 | Fc1cc(F)cc(F)c1Nc3nc2cnc(nc2n3C4CCOC4)NC5CCC(O)CC5 | OpenEye OEToolkits 1.7.2 | c1c(cc(c(c1F)Nc2nc3cnc(nc3n2C4CCOC4)NC5CCC(CC5)O)F)F | OpenEye OEToolkits 1.7.2 | c1c(cc(c(c1F)Nc2nc3cnc(nc3n2[C@H]4CCOC4)NC5CCC(CC5)O)F)F | CACTVS 3.370 | O[CH]1CC[CH](CC1)Nc2ncc3nc(Nc4c(F)cc(F)cc4F)n([CH]5CCOC5)c3n2 |
|
Formula | C21 H23 F3 N6 O2 |
Name | trans-4-({9-[(3S)-tetrahydrofuran-3-yl]-8-[(2,4,6-trifluorophenyl)amino]-9H-purin-2-yl}amino)cyclohexanol |
ChEMBL | CHEMBL1950289 |
DrugBank | DB11798 |
ZINC | ZINC000102930548
|
PDB chain | 3tti Chain A Residue 465
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|