Structure of PDB 3tjd Chain A Binding Site BS01 |
|
|
Ligand ID | 6TP |
InChI | InChI=1S/C19H22N4O3S2/c1-19(2,3)23-28(25,26)12-7-5-11(6-8-12)15-9-13-16(27-15)14(18(24)21-4)10-22-17(13)20/h5-10,23H,1-4H3,(H2,20,22)(H,21,24) |
InChIKey | FVVCSMCEMMLEGG-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CNC(=O)c1cnc(N)c2cc(sc12)c3ccc(cc3)[S](=O)(=O)NC(C)(C)C | ACDLabs 12.01 | O=S(=O)(NC(C)(C)C)c3ccc(c2sc1c(cnc(c1c2)N)C(=O)NC)cc3 | OpenEye OEToolkits 1.7.2 | CC(C)(C)NS(=O)(=O)c1ccc(cc1)c2cc3c(s2)c(cnc3N)C(=O)NC |
|
Formula | C19 H22 N4 O3 S2 |
Name | 4-amino-2-[4-(tert-butylsulfamoyl)phenyl]-N-methylthieno[3,2-c]pyridine-7-carboxamide |
ChEMBL | CHEMBL1938654 |
DrugBank | |
ZINC | ZINC000073224615
|
PDB chain | 3tjd Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|