Structure of PDB 3t9t Chain A Binding Site BS01 |
|
|
Ligand ID | IAQ |
InChI | InChI=1S/C24H25FN6O/c1-16-8-5-6-9-18(16)27-24-22-14-26-15-31(22)21-13-20(17(25)12-19(21)28-24)30(4)23(32)10-7-11-29(2)3/h5-10,12-15H,11H2,1-4H3,(H,27,28)/b10-7- |
InChIKey | YMSXHRWUGLAAKL-YFHOEESVSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.2 | Cc1ccccc1Nc2c3cncn3c4cc(c(cc4n2)F)N(C)C(=O)C=CCN(C)C | OpenEye OEToolkits 1.7.2 | Cc1ccccc1Nc2c3cncn3c4cc(c(cc4n2)F)N(C)C(=O)/C=C\CN(C)C | CACTVS 3.370 | CN(C)C\C=C/C(=O)N(C)c1cc2n3cncc3c(Nc4ccccc4C)nc2cc1F | ACDLabs 12.01 | O=C(\C=C/CN(C)C)N(c2c(F)cc1nc(c3cncn3c1c2)Nc4ccccc4C)C | CACTVS 3.370 | CN(C)CC=CC(=O)N(C)c1cc2n3cncc3c(Nc4ccccc4C)nc2cc1F |
|
Formula | C24 H25 F N6 O |
Name | (2Z)-4-(dimethylamino)-N-{7-fluoro-4-[(2-methylphenyl)amino]imidazo[1,5-a]quinoxalin-8-yl}-N-methylbut-2-enamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095921161
|
PDB chain | 3t9t Chain A Residue 800
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|