Structure of PDB 3t3u Chain A Binding Site BS01 |
|
|
Ligand ID | BK6 |
InChI | InChI=1S/C22H24N6O/c1-29-18-5-4-15-10-17(3-2-16(15)11-18)20-19-21(23)25-13-26-22(19)28(27-20)12-14-6-8-24-9-7-14/h2-5,10-11,13-14,24H,6-9,12H2,1H3,(H2,23,25,26) |
InChIKey | MBHHJCMRPHUOAD-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.2 | COc1ccc2cc(ccc2c1)c3c4c(ncnc4n(n3)CC5CCNCC5)N | CACTVS 3.370 | COc1ccc2cc(ccc2c1)c3nn(CC4CCNCC4)c5ncnc(N)c35 | ACDLabs 12.01 | n1c(c2c(nc1)n(nc2c4cc3ccc(OC)cc3cc4)CC5CCNCC5)N |
|
Formula | C22 H24 N6 O |
Name | 3-(6-methoxynaphthalen-2-yl)-1-(piperidin-4-ylmethyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine; RM-1-130 |
ChEMBL | CHEMBL2030553 |
DrugBank | |
ZINC | ZINC000084668816
|
PDB chain | 3t3u Chain A Residue 701
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|