Structure of PDB 3t1d Chain A Binding Site BS01 |
|
|
Ligand ID | TD1 |
InChI | InChI=1S/C13H16N2O8/c14-7(4-16)13(22)23-5-8(12(20)21)15-11(19)6-2-1-3-9(17)10(6)18/h1-3,7-8,16-18H,4-5,14H2,(H,15,19)(H,20,21)/t7-,8-/m0/s1 |
InChIKey | NNOZTAPXJBUXBD-YUMQZZPRSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | N[C@@H](CO)C(=O)OC[C@H](NC(=O)c1cccc(O)c1O)C(O)=O | CACTVS 3.370 | N[CH](CO)C(=O)OC[CH](NC(=O)c1cccc(O)c1O)C(O)=O | OpenEye OEToolkits 1.7.2 | c1cc(c(c(c1)O)O)C(=O)NC(COC(=O)C(CO)N)C(=O)O | OpenEye OEToolkits 1.7.2 | c1cc(c(c(c1)O)O)C(=O)N[C@@H](COC(=O)[C@H](CO)N)C(=O)O | ACDLabs 12.01 | O=C(O)C(NC(=O)c1cccc(O)c1O)COC(=O)C(N)CO |
|
Formula | C13 H16 N2 O8 |
Name | O-[(2S)-2-amino-3-hydroxypropanoyl]-N-(2,3-dihydroxybenzoyl)-L-serine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920670
|
PDB chain | 3t1d Chain A Residue 186
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|