Structure of PDB 3svf Chain A Binding Site BS01 |
|
|
Ligand ID | WDR |
InChI | InChI=1S/C16H19N3O4/c1-9-14(10(2)23-18-9)11-4-5-13-12(8-11)15(22-7-6-20)19(3)16(21)17-13/h4-5,8,15,20H,6-7H2,1-3H3,(H,17,21)/t15-/m0/s1 |
InChIKey | PRJSSNHOEZPGMA-HNNXBMFYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.2 | Cc1c(c(on1)C)c2ccc3c(c2)[C@@H](N(C(=O)N3)C)OCCO | OpenEye OEToolkits 1.7.2 | Cc1c(c(on1)C)c2ccc3c(c2)C(N(C(=O)N3)C)OCCO | ACDLabs 12.01 | O=C3Nc2c(cc(c1c(onc1C)C)cc2)C(OCCO)N3C | CACTVS 3.370 | CN1[CH](OCCO)c2cc(ccc2NC1=O)c3c(C)onc3C | CACTVS 3.370 | CN1[C@@H](OCCO)c2cc(ccc2NC1=O)c3c(C)onc3C |
|
Formula | C16 H19 N3 O4 |
Name | (4S)-6-(3,5-dimethyl-1,2-oxazol-4-yl)-4-(2-hydroxyethoxy)-3-methyl-3,4-dihydroquinazolin-2(1H)-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098209576
|
PDB chain | 3svf Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|