Structure of PDB 3spc Chain A Binding Site BS01 |
|
|
Ligand ID | P8P |
InChI | InChI=1S/C19H38O11P2/c1-3-5-7-9-11-13-18(20)27-15-17(16-28-32(25,26)30-31(22,23)24)29-19(21)14-12-10-8-6-4-2/h17H,3-16H2,1-2H3,(H,25,26)(H2,22,23,24)/t17-/m1/s1 |
InChIKey | MBDSUZSCJLRKPC-QGZVFWFLSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.2 | CCCCCCCC(=O)OCC(COP(=O)(O)OP(=O)(O)O)OC(=O)CCCCCCC | ACDLabs 12.01 | O=P(O)(O)OP(=O)(OCC(OC(=O)CCCCCCC)COC(=O)CCCCCCC)O | CACTVS 3.370 | CCCCCCCC(=O)OC[CH](CO[P](O)(=O)O[P](O)(O)=O)OC(=O)CCCCCCC | OpenEye OEToolkits 1.7.2 | CCCCCCCC(=O)OC[C@H](CO[P@@](=O)(O)OP(=O)(O)O)OC(=O)CCCCCCC | CACTVS 3.370 | CCCCCCCC(=O)OC[C@H](CO[P](O)(=O)O[P](O)(O)=O)OC(=O)CCCCCCC |
|
Formula | C19 H38 O11 P2 |
Name | (2R)-3-{[(R)-hydroxy(phosphonooxy)phosphoryl]oxy}propane-1,2-diyl dioctanoate; dioctanoylglycerol pyrophosphate |
ChEMBL | CHEMBL191055 |
DrugBank | |
ZINC |
|
PDB chain | 3spc Chain A Residue 379
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|