Structure of PDB 3smi Chain A Binding Site BS01 |
|
|
Ligand ID | QDR |
InChI | InChI=1S/C12H12N6OS/c1-6-3-2-4-7-9(6)14-8(15-10(7)19)5-20-12-16-11(13)17-18-12/h2-4H,5H2,1H3,(H,14,15,19)(H3,13,16,17,18) |
InChIKey | QKVQIWSGFFADDR-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.2 | Cc1cccc2c1N=C(NC2=O)CSc3[nH]nc(n3)N | CACTVS 3.370 | Cc1cccc2C(=O)NC(=Nc12)CSc3[nH]nc(N)n3 | ACDLabs 12.01 | O=C1c3cccc(c3N=C(N1)CSc2nc(nn2)N)C |
|
Formula | C12 H12 N6 O S |
Name | 2-{[(3-amino-1H-1,2,4-triazol-5-yl)sulfanyl]methyl}-8-methylquinazolin-4(3H)-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000007897353
|
PDB chain | 3smi Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|