Structure of PDB 3sff Chain A Binding Site BS01 |
|
|
Ligand ID | 0DI |
InChI | InChI=1S/C20H20ClF2N3O2/c21-14-3-1-2-13(10-14)11-18(24)20(28)26-8-6-25(7-9-26)19(27)16-12-15(22)4-5-17(16)23/h1-5,10,12,18H,6-9,11,24H2/t18-/m1/s1 |
InChIKey | NASCAWUSOSJBJH-GOSISDBHSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.2 | c1cc(cc(c1)Cl)CC(C(=O)N2CCN(CC2)C(=O)c3cc(ccc3F)F)N | OpenEye OEToolkits 1.7.2 | c1cc(cc(c1)Cl)C[C@H](C(=O)N2CCN(CC2)C(=O)c3cc(ccc3F)F)N | CACTVS 3.370 | N[CH](Cc1cccc(Cl)c1)C(=O)N2CCN(CC2)C(=O)c3cc(F)ccc3F | CACTVS 3.370 | N[C@H](Cc1cccc(Cl)c1)C(=O)N2CCN(CC2)C(=O)c3cc(F)ccc3F | ACDLabs 12.01 | O=C(N2CCN(C(=O)c1cc(F)ccc1F)CC2)C(N)Cc3cccc(Cl)c3 |
|
Formula | C20 H20 Cl F2 N3 O2 |
Name | (2R)-2-amino-3-(3-chlorophenyl)-1-[4-(2,5-difluorobenzoyl)piperazin-1-yl]propan-1-one |
ChEMBL | CHEMBL1812334 |
DrugBank | |
ZINC | ZINC000072105412
|
PDB chain | 3sff Chain A Residue 378
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|