Structure of PDB 3s7m Chain A Binding Site BS01 |
|
|
Ligand ID | 532 |
InChI | InChI=1S/C19H16N4OS/c1-23-17(24)19(22-18(23)20,16-7-9-25-12-16)15-6-2-4-13(10-15)14-5-3-8-21-11-14/h2-12H,1H3,(H2,20,22)/t19-/m0/s1 |
InChIKey | AOGBXAFIKRFUPJ-IBGZPJMESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CN1C(=N[C](C1=O)(c2cscc2)c3cccc(c3)c4cccnc4)N | OpenEye OEToolkits 1.7.2 | CN1C(=O)[C@](N=C1N)(c2cccc(c2)c3cccnc3)c4ccsc4 | CACTVS 3.370 | CN1C(=N[C@](C1=O)(c2cscc2)c3cccc(c3)c4cccnc4)N | OpenEye OEToolkits 1.7.2 | CN1C(=O)C(N=C1N)(c2cccc(c2)c3cccnc3)c4ccsc4 | ACDLabs 12.01 | O=C4N(C(=NC4(c1ccsc1)c3cccc(c2cccnc2)c3)N)C |
|
Formula | C19 H16 N4 O S |
Name | (5S)-2-amino-3-methyl-5-[3-(pyridin-3-yl)phenyl]-5-(thiophen-3-yl)-3,5-dihydro-4H-imidazol-4-one; WAY-253284 |
ChEMBL | |
DrugBank | |
ZINC | ZINC000034803241
|
PDB chain | 3s7m Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|