Structure of PDB 3s7l Chain A Binding Site BS01 |
|
|
Ligand ID | 591 |
InChI | InChI=1S/C19H19N7O/c1-3-26-11-16(10-23-26)19(17(27)25(2)18(20)24-19)15-6-4-5-13(7-15)14-8-21-12-22-9-14/h4-12H,3H2,1-2H3,(H2,20,24)/t19-/m0/s1 |
InChIKey | DNDFMOOQRXKYQL-IBGZPJMESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CCn1cc(cn1)[C]2(N=C(N)N(C)C2=O)c3cccc(c3)c4cncnc4 | CACTVS 3.370 | CCn1cc(cn1)[C@@]2(N=C(N)N(C)C2=O)c3cccc(c3)c4cncnc4 | ACDLabs 12.01 | O=C4N(C(=NC4(c1cn(nc1)CC)c3cccc(c2cncnc2)c3)N)C | OpenEye OEToolkits 1.7.2 | CCn1cc(cn1)C2(C(=O)N(C(=N2)N)C)c3cccc(c3)c4cncnc4 | OpenEye OEToolkits 1.7.2 | CCn1cc(cn1)[C@]2(C(=O)N(C(=N2)N)C)c3cccc(c3)c4cncnc4 |
|
Formula | C19 H19 N7 O |
Name | (5S)-2-amino-5-(1-ethyl-1H-pyrazol-4-yl)-3-methyl-5-[3-(pyrimidin-5-yl)phenyl]-3,5-dihydro-4H-imidazol-4-one; WAY-256591 |
ChEMBL | |
DrugBank | |
ZINC | ZINC000072181808
|
PDB chain | 3s7l Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|