Structure of PDB 3s4j Chain A Binding Site BS01 |
|
|
Ligand ID | UNV |
InChI | InChI=1S/C8H11NO6P2/c10-16(11,12)8(17(13,14)15)4-6-2-1-3-9-7(6)5-8/h1-3H,4-5H2,(H2,10,11,12)(H2,13,14,15) |
InChIKey | BKUBDCZNHKIXPI-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.2 | c1cc2c(nc1)CC(C2)(P(=O)(O)O)P(=O)(O)O | CACTVS 3.370 | O[P](O)(=O)C1(Cc2cccnc2C1)[P](O)(O)=O | ACDLabs 12.01 | O=P(O)(O)C2(Cc1cccnc1C2)P(=O)(O)O |
|
Formula | C8 H11 N O6 P2 |
Name | 6,7-dihydro-5H-cyclopenta[b]pyridine-6,6-diylbis(phosphonic acid) |
ChEMBL | CHEMBL317313 |
DrugBank | |
ZINC | ZINC000026733744
|
PDB chain | 3s4j Chain A Residue 901
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|