Structure of PDB 3s22 Chain A Binding Site BS01 |
|
|
Ligand ID | 3S2 |
InChI | InChI=1S/C11H22N4O5S/c1-12-5-2-3-6-13-11(17)15-7-4-9(10(15)8-16)14-21(18,19)20/h8-10,12,14H,2-7H2,1H3,(H,13,17)(H,18,19,20)/t9-,10-/m1/s1 |
InChIKey | KICDPLXBZKSLNF-NXEZZACHSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.2 | CNCCCCNC(=O)N1CC[C@H]([C@H]1C=O)NS(=O)(=O)O | CACTVS 3.370 | CNCCCCNC(=O)N1CC[C@@H](N[S](O)(=O)=O)[C@H]1C=O | OpenEye OEToolkits 1.7.2 | CNCCCCNC(=O)N1CCC(C1C=O)NS(=O)(=O)O | CACTVS 3.370 | CNCCCCNC(=O)N1CC[CH](N[S](O)(=O)=O)[CH]1C=O | ACDLabs 12.01 | O=C(NCCCCNC)N1C(C=O)C(NS(=O)(=O)O)CC1 |
|
Formula | C11 H22 N4 O5 S |
Name | [(2S,3R)-2-formyl-1-{[4-(methylamino)butyl]carbamoyl}pyrrolidin-3-yl]sulfamic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000066167056
|
PDB chain | 3s22 Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|