Structure of PDB 3rvg Chain A Binding Site BS01 |
|
|
Ligand ID | 17P |
InChI | InChI=1S/C22H24N6O/c1-28-12-14(10-25-28)13-7-8-16-18(9-13)27-20-17(21(23)29)11-24-22(19(16)20)26-15-5-3-2-4-6-15/h7-12,15,27H,2-6H2,1H3,(H2,23,29)(H,24,26) |
InChIKey | NSYNFVRSQTTZAL-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | Cn1cc(cn1)c2ccc3c([nH]c4c(cnc(NC5CCCCC5)c34)C(N)=O)c2 | OpenEye OEToolkits 1.7.2 | Cn1cc(cn1)c2ccc3c(c2)[nH]c4c3c(ncc4C(=O)N)NC5CCCCC5 | ACDLabs 12.01 | O=C(N)c4cnc(NC1CCCCC1)c5c3c(cc(c2cn(nc2)C)cc3)nc45 |
|
Formula | C22 H24 N6 O |
Name | 1-(cyclohexylamino)-7-(1-methyl-1H-pyrazol-4-yl)-5H-pyrido[4,3-b]indole-4-carboxamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095921282
|
PDB chain | 3rvg Chain A Residue 2000
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|