Structure of PDB 3ru1 Chain A Binding Site BS01 |
|
|
Ligand ID | 3RU |
InChI | InChI=1S/C19H25N3O/c20-19-16(12-15-8-4-5-9-17(15)22-19)10-11-18(23)21-13-14-6-2-1-3-7-14/h4-5,8-9,12,14H,1-3,6-7,10-11,13H2,(H2,20,22)(H,21,23) |
InChIKey | YOUIXYWUUXULRM-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.2 | c1ccc2c(c1)cc(c(n2)N)CCC(=O)NCC3CCCCC3 | CACTVS 3.370 | Nc1nc2ccccc2cc1CCC(=O)NCC3CCCCC3 | ACDLabs 12.01 | O=C(NCC1CCCCC1)CCc2cc3ccccc3nc2N |
|
Formula | C19 H25 N3 O |
Name | 3-(2-aminoquinolin-3-yl)-N-(cyclohexylmethyl)propanamide |
ChEMBL | CHEMBL1821813 |
DrugBank | |
ZINC | ZINC000072142734
|
PDB chain | 3ru1 Chain A Residue 398
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|