Structure of PDB 3rtp Chain A Binding Site BS01 |
|
|
Ligand ID | 34I |
InChI | InChI=1S/C18H14N6O2S/c19-7-12-9-27-18(16(12)17-20-10-21-23-17)22-14(25)8-24-13-4-2-1-3-11(13)5-6-15(24)26/h1-4,9-10H,5-6,8H2,(H,22,25)(H,20,21,23) |
InChIKey | WNRCGOJLZOLSJN-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.2 | c1ccc2c(c1)CCC(=O)N2CC(=O)Nc3c(c(cs3)C#N)c4[nH]ncn4 | ACDLabs 12.01 | N#Cc2c(c1ncnn1)c(sc2)NC(=O)CN4c3ccccc3CCC4=O | CACTVS 3.370 | O=C(CN1C(=O)CCc2ccccc12)Nc3scc(C#N)c3c4[nH]ncn4 |
|
Formula | C18 H14 N6 O2 S |
Name | N-[4-cyano-3-(1H-1,2,4-triazol-5-yl)thiophen-2-yl]-2-(2-oxo-3,4-dihydroquinolin-1(2H)-yl)acetamide |
ChEMBL | CHEMBL1682015 |
DrugBank | |
ZINC | ZINC000066077420
|
PDB chain | 3rtp Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|