Structure of PDB 3rt8 Chain A Binding Site BS01 |
|
|
Ligand ID | CWD |
InChI | InChI=1S/C7H8ClN3O4/c8-3-1-11(2-4(9)6(13)14)7(15)10-5(3)12/h1,4H,2,9H2,(H,13,14)(H,10,12,15)/t4-/m0/s1 |
InChIKey | HEHLSRRDKJVHOM-BYPYZUCNSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.2 | C1=C(C(=O)NC(=O)N1C[C@@H](C(=O)O)N)Cl | CACTVS 3.370 | N[C@@H](CN1C=C(Cl)C(=O)NC1=O)C(O)=O | ACDLabs 12.01 | O=C(O)C(N)CN1C=C(Cl)C(=O)NC1=O | OpenEye OEToolkits 1.7.2 | C1=C(C(=O)NC(=O)N1CC(C(=O)O)N)Cl | CACTVS 3.370 | N[CH](CN1C=C(Cl)C(=O)NC1=O)C(O)=O |
|
Formula | C7 H8 Cl N3 O4 |
Name | 3-(5-chloro-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-L-alanine; chlorowillardiine |
ChEMBL | CHEMBL121388 |
DrugBank | |
ZINC |
|
PDB chain | 3rt8 Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|