Structure of PDB 3rop Chain A Binding Site BS01 |
|
|
Ligand ID | 50A |
InChI | InChI=1S/C5H10FO7P/c6-3-4(7)2(13-5(3)8)1-12-14(9,10)11/h2-5,7-8H,1H2,(H2,9,10,11)/t2-,3-,4-,5+/m1/s1 |
InChIKey | NOTDWSJIOCLYHZ-AIHAYLRMSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | FC1C(O)C(OC1O)COP(=O)(O)O | CACTVS 3.370 | O[CH]1O[CH](CO[P](O)(O)=O)[CH](O)[CH]1F | OpenEye OEToolkits 1.7.6 | C(C1C(C(C(O1)O)F)O)OP(=O)(O)O | OpenEye OEToolkits 1.7.6 | C([C@@H]1[C@H]([C@H]([C@H](O1)O)F)O)OP(=O)(O)O | CACTVS 3.370 | O[C@H]1O[C@H](CO[P](O)(O)=O)[C@@H](O)[C@H]1F |
|
Formula | C5 H10 F O7 P |
Name | 2-deoxy-2-fluoro-5-O-phosphono-alpha-D-ribofuranose; Inhibitor CZ-50b arabinosyl-2-fluoro-2-deoxynicotinamide mononucleotide, bound form; 2-deoxy-2-fluoro-5-O-phosphono-alpha-D-ribose; 2-deoxy-2-fluoro-5-O-phosphono-D-ribose; 2-deoxy-2-fluoro-5-O-phosphono-ribose |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098208501
|
PDB chain | 3rop Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
E146 T221 E226 |
Catalytic site (residue number reindexed from 1) |
E102 T177 E182 |
Enzyme Commision number |
2.4.99.20: 2'-phospho-ADP-ribosyl cyclase/2'-phospho-cyclic-ADP-ribose transferase. 3.2.2.- 3.2.2.6: ADP-ribosyl cyclase/cyclic ADP-ribose hydrolase. |
|
|
|