Structure of PDB 3ro4 Chain A Binding Site BS01 |
|
|
Ligand ID | LJ9 |
InChI | InChI=1S/C21H24N4/c1-2-20-19-9-8-18(24-13-15-11-22-12-16(15)14-24)10-21(19)25(23-20)17-6-4-3-5-7-17/h3-10,15-16,22H,2,11-14H2,1H3/t15-,16+ |
InChIKey | JRGJWNYNELQBIY-IYBDPMFKSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.2 | CCc1c2ccc(cc2n(n1)c3ccccc3)N4CC5CNCC5C4 | ACDLabs 12.01 | n2c(c1ccc(cc1n2c3ccccc3)N5CC4CNCC4C5)CC | OpenEye OEToolkits 1.7.2 | CCc1c2ccc(cc2n(n1)c3ccccc3)N4C[C@H]5CNC[C@H]5C4 | CACTVS 3.370 | CCc1nn(c2ccccc2)c3cc(ccc13)N4C[C@@H]5CNC[C@@H]5C4 | CACTVS 3.370 | CCc1nn(c2ccccc2)c3cc(ccc13)N4C[CH]5CNC[CH]5C4 |
|
Formula | C21 H24 N4 |
Name | 3-ethyl-6-[(3aR,6aS)-hexahydropyrrolo[3,4-c]pyrrol-2(1H)-yl]-1-phenyl-1H-indazole |
ChEMBL | |
DrugBank | |
ZINC | ZINC000072142437
|
PDB chain | 3ro4 Chain B Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|