Structure of PDB 3rhk Chain A Binding Site BS01 |
|
|
Ligand ID | M97 |
InChI | InChI=1S/C23H15N3O2/c27-22-19(16-11-24-18-9-2-1-7-14(16)18)20(23(28)25-22)17-12-26-10-4-6-13-5-3-8-15(17)21(13)26/h1-12,19-20,24H/p+1/t19-,20-/m0/s1 |
InChIKey | DVSVKPFSHABFPS-PMACEKPBSA-O |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | O=C1NC(=O)[C@H]([C@@H]1c2c[nH]c3ccccc23)C4=C[n+]5cccc6cccc4c56 | OpenEye OEToolkits 1.7.0 | c1ccc2c(c1)c(c[nH]2)[C@H]3[C@@H](C(=O)NC3=O)C4=C[n+]5cccc6c5c4ccc6 | CACTVS 3.370 | O=C1NC(=O)[CH]([CH]1c2c[nH]c3ccccc23)C4=C[n+]5cccc6cccc4c56 | OpenEye OEToolkits 1.7.0 | c1ccc2c(c1)c(c[nH]2)C3C(C(=O)NC3=O)C4=C[n+]5cccc6c5c4ccc6 | ACDLabs 12.01 | O=C6NC(=O)C(C=3c1c2c(ccc1)ccc[n+]2C=3)C6c4cnc5ccccc45 |
|
Formula | C23 H16 N3 O2 |
Name | 1-[(3R,4R)-4-(1H-indol-3-yl)-2,5-dioxopyrrolidin-3-yl]pyrrolo[3,2,1-ij]quinolinium |
ChEMBL | |
DrugBank | |
ZINC | ZINC000066157033
|
PDB chain | 3rhk Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|