Structure of PDB 3r33 Chain A Binding Site BS01 |
|
|
Ligand ID | 6ME |
InChI | InChI=1S/C9H14N4/c1-5-2-3-7-6(4-5)8(10)13-9(11)12-7/h5H,2-4H2,1H3,(H4,10,11,12,13)/t5-/m0/s1 |
InChIKey | NQHPYDRZSXDOSD-YFKPBYRVSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | CC1CCc2c(c(nc(n2)N)N)C1 | CACTVS 3.370 | C[CH]1CCc2nc(N)nc(N)c2C1 | OpenEye OEToolkits 1.7.0 | C[C@H]1CCc2c(c(nc(n2)N)N)C1 | CACTVS 3.370 | C[C@H]1CCc2nc(N)nc(N)c2C1 | ACDLabs 12.01 | n1c2c(c(nc1N)N)CC(CC2)C |
|
Formula | C9 H14 N4 |
Name | (6S)-6-methyl-5,6,7,8-tetrahydroquinazoline-2,4-diamine |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 3r33 Chain A Residue 161
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|