Structure of PDB 3qcx Chain A Binding Site BS01 |
|
|
Ligand ID | 3Q2 |
InChI | InChI=1S/C16H19N7O/c1-9-8-24-5-4-23(9)14-7-12(19-16(18)20-14)10-2-3-11-13(6-10)21-22-15(11)17/h2-3,6-7,9H,4-5,8H2,1H3,(H3,17,21,22)(H2,18,19,20)/t9-/m1/s1 |
InChIKey | WNVXQKKSIHKYCX-SECBINFHSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | CC1COCCN1c2cc(nc(n2)N)c3ccc4c(c3)n[nH]c4N | OpenEye OEToolkits 1.7.0 | C[C@@H]1COCC[N@@]1c2cc(nc(n2)N)c3ccc4c(c3)n[nH]c4N | ACDLabs 12.01 | n3c(nc(c2ccc1c(N)nnc1c2)cc3N4C(COCC4)C)N | CACTVS 3.370 | C[C@@H]1COCCN1c2cc(nc(N)n2)c3ccc4c(N)[nH]nc4c3 | CACTVS 3.370 | C[CH]1COCCN1c2cc(nc(N)n2)c3ccc4c(N)[nH]nc4c3 |
|
Formula | C16 H19 N7 O |
Name | 6-{2-amino-6-[(3R)-3-methylmorpholin-4-yl]pyrimidin-4-yl}-2H-indazol-3-amine |
ChEMBL | CHEMBL1614773 |
DrugBank | |
ZINC | ZINC000064502328
|
PDB chain | 3qcx Chain A Residue 370
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|