Structure of PDB 3qbn Chain A Binding Site BS01 |
|
|
Ligand ID | E9Z |
InChI | InChI=1S/C16H19ClN4O2/c1-22-8-9-23-13-6-4-12(5-7-13)20-16-18-10-14(17)15(21-16)19-11-2-3-11/h4-7,10-11H,2-3,8-9H2,1H3,(H2,18,19,20,21) |
InChIKey | JFFMERHILPGKFE-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | Clc1cnc(nc1NC2CC2)Nc3ccc(OCCOC)cc3 | OpenEye OEToolkits 1.7.0 | COCCOc1ccc(cc1)Nc2ncc(c(n2)NC3CC3)Cl | CACTVS 3.370 | COCCOc1ccc(Nc2ncc(Cl)c(NC3CC3)n2)cc1 |
|
Formula | C16 H19 Cl N4 O2 |
Name | 5-chloro-N~4~-cyclopropyl-N~2~-[4-(2-methoxyethoxy)phenyl]pyrimidine-2,4-diamine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098208818
|
PDB chain | 3qbn Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|