Structure of PDB 3pn1 Chain A Binding Site BS01 |
|
|
Ligand ID | IVH |
InChI | InChI=1S/C14H21N5O4S/c1-2-3-4-24-14-17-11(15)8-12(18-14)19(6-16-8)13-10(22)9(21)7(5-20)23-13/h6-7,9-10,13,20-22H,2-5H2,1H3,(H2,15,17,18)/t7-,9-,10-,13-/m1/s1 |
InChIKey | JUZWTKSKLZRPBL-QYVSTXNMSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CCCCSc1nc(N)c2ncn([CH]3O[CH](CO)[CH](O)[CH]3O)c2n1 | OpenEye OEToolkits 1.7.0 | CCCCSc1nc(c2c(n1)n(cn2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N | ACDLabs 12.01 | n2c1c(nc(SCCCC)nc1n(c2)C3OC(C(O)C3O)CO)N | OpenEye OEToolkits 1.7.0 | CCCCSc1nc(c2c(n1)n(cn2)C3C(C(C(O3)CO)O)O)N | CACTVS 3.370 | CCCCSc1nc(N)c2ncn([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c2n1 |
|
Formula | C14 H21 N5 O4 S |
Name | 2-(butylsulfanyl)adenosine |
ChEMBL | CHEMBL1233689 |
DrugBank | |
ZINC | ZINC000039178283
|
PDB chain | 3pn1 Chain A Residue 319
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|