Structure of PDB 3pds Chain A Binding Site BS01 |
|
|
Ligand ID | ERC |
InChI | InChI=1S/C23H28N2O5S/c1-29-21-13-15(3-7-20(21)30-11-2-12-31)9-10-24-14-19(27)16-4-6-18(26)23-17(16)5-8-22(28)25-23/h3-8,13,19,24,26-27,31H,2,9-12,14H2,1H3,(H,25,28)/t19-/m0/s1 |
InChIKey | WAQRESHSGHIXBV-IBGZPJMESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | COc1cc(CCNC[C@H](O)c2ccc(O)c3NC(=O)C=Cc23)ccc1OCCCS | OpenEye OEToolkits 1.7.0 | COc1cc(ccc1OCCCS)CCNC[C@@H](c2ccc(c3c2C=CC(=O)N3)O)O | CACTVS 3.370 | COc1cc(CCNC[CH](O)c2ccc(O)c3NC(=O)C=Cc23)ccc1OCCCS | OpenEye OEToolkits 1.7.0 | COc1cc(ccc1OCCCS)CCNCC(c2ccc(c3c2C=CC(=O)N3)O)O | ACDLabs 12.01 | O=C3C=Cc1c(c(O)ccc1C(O)CNCCc2ccc(OCCCS)c(OC)c2)N3 |
|
Formula | C23 H28 N2 O5 S |
Name | 8-hydroxy-5-[(1R)-1-hydroxy-2-({2-[3-methoxy-4-(3-sulfanylpropoxy)phenyl]ethyl}amino)ethyl]quinolin-2(1H)-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000058660657
|
PDB chain | 3pds Chain A Residue 1201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
E1011 D1020 |
Catalytic site (residue number reindexed from 1) |
E212 D221 |
Enzyme Commision number |
3.2.1.17: lysozyme. |
|
|
|