Structure of PDB 3pd9 Chain A Binding Site BS01 |
|
|
Ligand ID | HA5 |
InChI | InChI=1S/C7H8N2O4/c10-6-3-1-4(7(11)12)8-2-5(3)13-9-6/h4,8H,1-2H2,(H,9,10)(H,11,12)/t4-/m1/s1 |
InChIKey | QOFAMUTZWHXYLI-SCSAIBSYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.5 | C1c2c(onc2O)CNC1C(=O)O | OpenEye OEToolkits 1.7.5 | C1c2c(onc2O)CN[C@H]1C(=O)O | CACTVS 3.385 | OC(=O)[CH]1Cc2c(O)noc2CN1 | CACTVS 3.385 | OC(=O)[C@H]1Cc2c(O)noc2CN1 |
|
Formula | C7 H8 N2 O4 |
Name | (5R)-3-hydroxy-4,5,6,7-tetrahydroisoxazolo[5,4-c]pyridine-5-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 3pd9 Chain A Residue 260
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|