Structure of PDB 3pa5 Chain A Binding Site BS01 |
|
|
Ligand ID | C73 |
InChI | InChI=1S/C17H19ClN4O2S/c18-11-5-3-10(4-6-11)14-8-13(16(25-14)22-17(19)24)15(23)21-12-2-1-7-20-9-12/h3-6,8,12,20H,1-2,7,9H2,(H,21,23)(H3,19,22,24)/t12-/m0/s1 |
InChIKey | MZBVMTJFZZINAF-LBPRGKRZSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | c1cc(ccc1c2cc(c(s2)NC(=O)N)C(=O)N[C@H]3CCCNC3)Cl | OpenEye OEToolkits 1.7.0 | c1cc(ccc1c2cc(c(s2)NC(=O)N)C(=O)NC3CCCNC3)Cl | ACDLabs 12.01 | O=C(Nc2sc(cc2C(=O)NC1CCCNC1)c3ccc(Cl)cc3)N | CACTVS 3.370 | NC(=O)Nc1sc(cc1C(=O)N[CH]2CCCNC2)c3ccc(Cl)cc3 | CACTVS 3.370 | NC(=O)Nc1sc(cc1C(=O)N[C@H]2CCCNC2)c3ccc(Cl)cc3 |
|
Formula | C17 H19 Cl N4 O2 S |
Name | 2-(carbamoylamino)-5-(4-chlorophenyl)-N-[(3S)-piperidin-3-yl]thiophene-3-carboxamide |
ChEMBL | CHEMBL470288 |
DrugBank | |
ZINC | ZINC000040394718
|
PDB chain | 3pa5 Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|