Structure of PDB 3oz0 Chain A Binding Site BS01 |
|
|
Ligand ID | 3OZ |
InChI | InChI=1S/C25H22Cl2N2O4/c1-15-10-16(6-9-22(15)33-14-23(30)31)12-29-13-17-4-2-3-5-19(17)24(29)25(32)28-21-8-7-18(26)11-20(21)27/h2-11,24H,12-14H2,1H3,(H,28,32)(H,30,31)/t24-/m0/s1 |
InChIKey | MRCUMHGGUAFXSG-DEOSSOPVSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | Cc1cc(ccc1OCC(=O)O)CN2Cc3ccccc3C2C(=O)Nc4ccc(cc4Cl)Cl | CACTVS 3.370 | Cc1cc(CN2Cc3ccccc3[CH]2C(=O)Nc4ccc(Cl)cc4Cl)ccc1OCC(O)=O | OpenEye OEToolkits 1.7.0 | Cc1cc(ccc1OCC(=O)O)C[N@@]2Cc3ccccc3[C@H]2C(=O)Nc4ccc(cc4Cl)Cl | ACDLabs 12.01 | Clc1ccc(c(Cl)c1)NC(=O)C3c2ccccc2CN3Cc4ccc(OCC(=O)O)c(c4)C | CACTVS 3.370 | Cc1cc(CN2Cc3ccccc3[C@H]2C(=O)Nc4ccc(Cl)cc4Cl)ccc1OCC(O)=O |
|
Formula | C25 H22 Cl2 N2 O4 |
Name | [4-({(1S)-1-[(2,4-dichlorophenyl)carbamoyl]-1,3-dihydro-2H-isoindol-2-yl}methyl)-2-methylphenoxy]acetic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000064479696
|
PDB chain | 3oz0 Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|