Structure of PDB 3oy1 Chain A Binding Site BS01 |
|
|
Ligand ID | 589 |
InChI | InChI=1S/C28H31N5O2/c34-28-32(25-11-10-20-6-4-5-7-21(20)18-25)27(31-33(28)24-13-16-35-17-14-24)22-12-15-29-26(19-22)30-23-8-2-1-3-9-23/h4-7,10-12,15,18-19,23-24H,1-3,8-9,13-14,16-17H2,(H,29,30) |
InChIKey | YZJYYYWPZRYBLV-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | O=C1N(N=C(N1c2ccc3ccccc3c2)c4ccnc(NC5CCCCC5)c4)C6CCOCC6 | ACDLabs 12.01 | O=C5N(N=C(c2ccnc(NC1CCCCC1)c2)N5c4cc3ccccc3cc4)C6CCOCC6 | OpenEye OEToolkits 1.7.0 | c1ccc2cc(ccc2c1)N3C(=NN(C3=O)C4CCOCC4)c5ccnc(c5)NC6CCCCC6 |
|
Formula | C28 H31 N5 O2 |
Name | 5-[2-(cyclohexylamino)pyridin-4-yl]-4-naphthalen-2-yl-2-(tetrahydro-2H-pyran-4-yl)-2,4-dihydro-3H-1,2,4-triazol-3-one |
ChEMBL | CHEMBL1644639 |
DrugBank | |
ZINC | ZINC000066252527
|
PDB chain | 3oy1 Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|