Structure of PDB 3ot3 Chain A Binding Site BS01 |
|
|
Ligand ID | 22K |
InChI | InChI=1S/C16H20BrN7/c1-23-8-10(6-20-23)12-7-21-24-15(19)13(17)14(22-16(12)24)9-3-2-4-11(18)5-9/h6-9,11H,2-5,18-19H2,1H3/t9-,11+/m1/s1 |
InChIKey | CKLKHZYNDIKOOE-KOLCDFICSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | Cn1cc(cn1)c2cnn3c(N)c(Br)c(nc23)[CH]4CCC[CH](N)C4 | OpenEye OEToolkits 1.7.0 | Cn1cc(cn1)c2cnn3c2nc(c(c3N)Br)C4CCCC(C4)N | OpenEye OEToolkits 1.7.0 | Cn1cc(cn1)c2cnn3c2nc(c(c3N)Br)[C@@H]4CCC[C@@H](C4)N | CACTVS 3.370 | Cn1cc(cn1)c2cnn3c(N)c(Br)c(nc23)[C@@H]4CCC[C@H](N)C4 | ACDLabs 12.01 | Brc1c(N)n3ncc(c3nc1C2CCCC(N)C2)c4cn(nc4)C |
|
Formula | C16 H20 Br N7 |
Name | 5-[(1R,3S)-3-aminocyclohexyl]-6-bromo-3-(1-methyl-1H-pyrazol-4-yl)pyrazolo[1,5-a]pyrimidin-7-amine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000058638484
|
PDB chain | 3ot3 Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|