Structure of PDB 3o31 Chain A Binding Site BS01 |
|
|
Ligand ID | 3O3 |
InChI | InChI=1S/C9H16N2O6/c10-5(8(14)15)3-4-11-6(9(16)17)1-2-7(12)13/h5-6,11H,1-4,10H2,(H,12,13)(H,14,15)(H,16,17)/t5-,6-/m0/s1 |
InChIKey | VTEXNADNTYNYRI-WDSKDSINSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | N[C@@H](CCN[C@@H](CCC(O)=O)C(O)=O)C(O)=O | ACDLabs 12.01 | O=C(O)C(NCCC(N)C(=O)O)CCC(=O)O | OpenEye OEToolkits 1.7.0 | C(CC(=O)O)C(C(=O)O)NCCC(C(=O)O)N | CACTVS 3.370 | N[CH](CCN[CH](CCC(O)=O)C(O)=O)C(O)=O | OpenEye OEToolkits 1.7.0 | C(CC(=O)O)[C@@H](C(=O)O)NCC[C@@H](C(=O)O)N |
|
Formula | C9 H16 N2 O6 |
Name | N-[(3S)-3-amino-3-carboxypropyl]-L-glutamic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000066166244
|
PDB chain | 3o31 Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|