Structure of PDB 3ny6 Chain A Binding Site BS01 |
|
|
Ligand ID | V30 |
InChI | InChI=1S/C12H15N3O3S2/c1-6-7(2)20-11-9(6)10(18)14-12(15-11)19-5-8(17)13-3-4-16/h16H,3-5H2,1-2H3,(H,13,17)(H,14,15,18) |
InChIKey | ICCYYTXQEBNXNT-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C1c2c(c(sc2N=C(SCC(=O)NCCO)N1)C)C | CACTVS 3.370 | Cc1sc2N=C(NC(=O)c2c1C)SCC(=O)NCCO | OpenEye OEToolkits 1.7.0 | Cc1c(sc2c1C(=O)NC(=N2)SCC(=O)NCCO)C |
|
Formula | C12 H15 N3 O3 S2 |
Name | 2-[(5,6-dimethyl-4-oxo-3,4-dihydrothieno[2,3-d]pyrimidin-2-yl)sulfanyl]-N-(2-hydroxyethyl)acetamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000008742812
|
PDB chain | 3ny6 Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
E581 |
Catalytic site (residue number reindexed from 1) |
E150 |
Enzyme Commision number |
2.4.2.36: NAD(+)--diphthamide ADP-ribosyltransferase. |
|
|
|