Structure of PDB 3nw7 Chain A Binding Site BS01 |
|
|
Ligand ID | LGV |
InChI | InChI=1S/C19H17FN8O/c20-15-6-5-12(9-21-15)19(29)22-10-17-24-18(14-2-1-7-28(14)27-17)23-16-8-13(25-26-16)11-3-4-11/h1-2,5-9,11H,3-4,10H2,(H,22,29)(H2,23,24,25,26,27) |
InChIKey | FQECDJFBKXFTIW-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | Fc1ncc(cc1)C(=O)NCc3nn2c(ccc2)c(n3)Nc4cc(nn4)C5CC5 | OpenEye OEToolkits 1.7.0 | c1cc2c(nc(nn2c1)CNC(=O)c3ccc(nc3)F)Nc4cc(n[nH]4)C5CC5 | CACTVS 3.370 | Fc1ccc(cn1)C(=O)NCc2nn3cccc3c(Nc4[nH]nc(c4)C5CC5)n2 |
|
Formula | C19 H17 F N8 O |
Name | N-({4-[(3-cyclopropyl-1H-pyrazol-5-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl}methyl)-6-fluoropyridine-3-carboxamide |
ChEMBL | CHEMBL1222855 |
DrugBank | |
ZINC | ZINC000058591398
|
PDB chain | 3nw7 Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|