Structure of PDB 3nmq Chain A Binding Site BS01 |
|
|
Ligand ID | 7PP |
InChI | InChI=1S/C21H24ClN5O2/c1-12-9-24-15(13(2)17(12)29-5)11-27-10-14(7-6-8-21(3,4)28)16-18(22)25-20(23)26-19(16)27/h9-10,28H,8,11H2,1-5H3,(H2,23,25,26) |
InChIKey | VOASEWXFCTZRDF-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | Clc1nc(nc2c1c(C#CCC(O)(C)C)cn2Cc3ncc(c(OC)c3C)C)N | CACTVS 3.370 | COc1c(C)cnc(Cn2cc(C#CCC(C)(C)O)c3c(Cl)nc(N)nc23)c1C | OpenEye OEToolkits 1.7.0 | Cc1cnc(c(c1OC)C)Cn2cc(c3c2nc(nc3Cl)N)C#CCC(C)(C)O |
|
Formula | C21 H24 Cl N5 O2 |
Name | 5-{2-amino-4-chloro-7-[(4-methoxy-3,5-dimethylpyridin-2-yl)methyl]-7H-pyrrolo[2,3-d]pyrimidin-5-yl}-2-methylpent-4-yn-2 -ol; EC44 |
ChEMBL | CHEMBL1230584 |
DrugBank | |
ZINC | ZINC000043132634
|
PDB chain | 3nmq Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|