Structure of PDB 3nfa Chain A Binding Site BS01 |
|
|
Ligand ID | CBJ |
InChI | InChI=1S/C18H12BrNO6/c19-10-2-3-12-11(7-10)15(21)17(22)20(12)8-9-1-4-13-16(14(9)18(23)24)26-6-5-25-13/h1-4,7H,5-6,8H2,(H,23,24) |
InChIKey | ALXMSKACQCRMOE-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(O)c2c(ccc1OCCOc12)CN4c3ccc(Br)cc3C(=O)C4=O | OpenEye OEToolkits 1.7.0 | c1cc2c(cc1Br)C(=O)C(=O)N2Cc3ccc4c(c3C(=O)O)OCCO4 | CACTVS 3.370 | OC(=O)c1c(CN2C(=O)C(=O)c3cc(Br)ccc23)ccc4OCCOc14 |
|
Formula | C18 H12 Br N O6 |
Name | 6-[(5-bromo-2,3-dioxo-2,3-dihydro-1H-indol-1-yl)methyl]-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000066166928
|
PDB chain | 3nfa Chain A Residue 213
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|