Structure of PDB 3nd7 Chain A Binding Site BS01 |
|
|
Ligand ID | PNY |
InChI | InChI=1S/C11H22N2O4S/c1-11(2,7-14)9(16)10(17)13-4-3-8(15)12-5-6-18/h9,14,16,18H,3-7H2,1-2H3,(H,12,15)(H,13,17)/t9-/m0/s1 |
InChIKey | ZNXZGRMVNNHPCA-VIFPVBQESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CC(C)(CO)[CH](O)C(=O)NCCC(=O)NCCS | OpenEye OEToolkits 1.7.0 | CC(C)(CO)[C@H](C(=O)NCCC(=O)NCCS)O | CACTVS 3.370 | CC(C)(CO)[C@@H](O)C(=O)NCCC(=O)NCCS | OpenEye OEToolkits 1.7.0 | CC(C)(CO)C(C(=O)NCCC(=O)NCCS)O | ACDLabs 12.01 | O=C(NCCS)CCNC(=O)C(O)C(C)(C)CO |
|
Formula | C11 H22 N2 O4 S |
Name | (2R)-2,4-dihydroxy-3,3-dimethyl-N-{3-oxo-3-[(2-sulfanylethyl)amino]propyl}butanamide; pantetheine; (R)-2,4-Dihydroxy-N-(3-((2-mercaptoethyl)amino)-3-oxopropyl)-3,3-dimethylbutanamide |
ChEMBL | CHEMBL1738861 |
DrugBank | |
ZINC | ZINC000003869684
|
PDB chain | 3nd7 Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
H18 R92 S130 |
Catalytic site (residue number reindexed from 1) |
H18 R86 S124 |
Enzyme Commision number |
2.7.7.3: pantetheine-phosphate adenylyltransferase. |
|
|
|