Structure of PDB 3n87 Chain A Binding Site BS01 |
|
|
Ligand ID | N87 |
InChI | InChI=1S/C20H18O6/c21-16-11-20(26,19(24)25)10-15(18(16)23)13-7-4-8-14(9-13)17(22)12-5-2-1-3-6-12/h1-10,16,18,21,23,26H,11H2,(H,24,25)/t16-,18-,20+/m1/s1 |
InChIKey | XHOCFTKQBAZROZ-POAQFYNOSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | c1ccc(cc1)C(=O)c2cccc(c2)C3=C[C@](C[C@H]([C@@H]3O)O)(C(=O)O)O | CACTVS 3.370 | O[C@@H]1C[C@@](O)(C=C([C@H]1O)c2cccc(c2)C(=O)c3ccccc3)C(O)=O | ACDLabs 12.01 | O=C(O)C3(O)C=C(c2cccc(C(=O)c1ccccc1)c2)C(O)C(O)C3 | OpenEye OEToolkits 1.7.0 | c1ccc(cc1)C(=O)c2cccc(c2)C3=CC(CC(C3O)O)(C(=O)O)O | CACTVS 3.370 | O[CH]1C[C](O)(C=C([CH]1O)c2cccc(c2)C(=O)c3ccccc3)C(O)=O |
|
Formula | C20 H18 O6 |
Name | (1R,4R,5R)-1,4,5-trihydroxy-3-[3-(phenylcarbonyl)phenyl]cyclohex-2-ene-1-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000066157181
|
PDB chain | 3n87 Chain A Residue 147
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|