Structure of PDB 3n2e Chain A Binding Site BS01 |
|
|
Ligand ID | OSA |
InChI | InChI=1S/C20H15N3O8S2/c21-12-1-3-16-10(5-12)8-18(33(29,30)31)19(20(16)25)23-22-13-2-4-15-11(6-13)7-14(9-17(15)24)32(26,27)28/h1-9,24-25H,21H2,(H,26,27,28)(H,29,30,31)/b23-22+ |
InChIKey | ZSHNSNDVNDUHIM-GHVJWSGMSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | c1cc2c(cc1N)cc(c(c2O)N=Nc3ccc4c(c3)cc(cc4O)S(=O)(=O)O)S(=O)(=O)O | CACTVS 3.370 | Nc1ccc2c(O)c(N=Nc3ccc4c(O)cc(cc4c3)[S](O)(=O)=O)c(cc2c1)[S](O)(=O)=O | ACDLabs 12.01 | O=S(=O)(O)c4cc3cc(/N=N/c2c(O)c1c(cc(cc1)N)cc2S(=O)(=O)O)ccc3c(O)c4 | OpenEye OEToolkits 1.7.0 | c1cc2c(cc1N)cc(c(c2O)/N=N/c3ccc4c(c3)cc(cc4O)S(=O)(=O)O)S(=O)(=O)O |
|
Formula | C20 H15 N3 O8 S2 |
Name | 7-amino-4-hydroxy-3-[(E)-(5-hydroxy-7-sulfonaphthalen-2-yl)diazenyl]naphthalene-2-sulfonic acid |
ChEMBL | CHEMBL1092443 |
DrugBank | |
ZINC | ZINC000005010475
|
PDB chain | 3n2e Chain A Residue 1001
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.7.1.71: shikimate kinase. |
|
|
|