Structure of PDB 3mxs Chain A Binding Site BS01 |
|
|
Ligand ID | CZ9 |
InChI | InChI=1S/C17H23BN4O7/c1-2-21-7-8-22(16(26)15(21)25)17(27)20-13(14(24)19-10-18(28)29)9-11-3-5-12(23)6-4-11/h3-6,13,23,28-29H,2,7-10H2,1H3,(H,19,24)(H,20,27)/t13-/m1/s1 |
InChIKey | INXKLMQPFNYGIK-CYBMUJFWSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CCN1CCN(C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)NCB(O)O)C(=O)C1=O | ACDLabs 12.01 | O=C(NCB(O)O)C(NC(=O)N1C(=O)C(=O)N(CC)CC1)Cc2ccc(O)cc2 | OpenEye OEToolkits 1.7.0 | B(CNC(=O)C(Cc1ccc(cc1)O)NC(=O)N2CCN(C(=O)C2=O)CC)(O)O | OpenEye OEToolkits 1.7.0 | B(CNC(=O)[C@@H](Cc1ccc(cc1)O)NC(=O)N2CCN(C(=O)C2=O)CC)(O)O | CACTVS 3.370 | CCN1CCN(C(=O)N[CH](Cc2ccc(O)cc2)C(=O)NCB(O)O)C(=O)C1=O |
|
Formula | C17 H23 B N4 O7 |
Name | N-[(dihydroxyboranyl)methyl]-Nalpha-[(4-ethyl-2,3-dioxopiperazin-1-yl)carbonyl]-D-tyrosinamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000198032157
|
PDB chain | 3mxs Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|